About N,N-dimethylmethanamine;silylsilane
N,N-dimethylmethanamine;silylsilane (PubChem CID 172757602) has the molecular formula C3H15NSi2
and a molecular weight of 121.33 g/mol. Its IUPAC name is N,N-dimethylmethanamine;silylsilane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;silylsilane |
| PubChem CID | 172757602 |
| Molecular Formula | C3H15NSi2 |
| Molecular Weight | 121.33 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | N,N-dimethylmethanamine;silylsilane |
| SMILES | CN(C)C.[SiH3][SiH3] |
| InChI | InChI=1S/C3H9N.H6Si2/c1-4(2)3;1-2/h1-3H3;1-2H3 |
| InChIKey | LFYSTQTZYYFOPJ-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.33 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;silylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;silylsilane?
The IUPAC name of N,N-dimethylmethanamine;silylsilane (CID 172757602) is N,N-dimethylmethanamine;silylsilane.
What is the SMILES notation for N,N-dimethylmethanamine;silylsilane?
The canonical SMILES for N,N-dimethylmethanamine;silylsilane is CN(C)C.[SiH3][SiH3].
What is the InChIKey of N,N-dimethylmethanamine;silylsilane?
The InChIKey is LFYSTQTZYYFOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.H6Si2/c1-4(2)3;1-2/h1-3H3;1-2H3.
What are the key properties of N,N-dimethylmethanamine;silylsilane?
N,N-dimethylmethanamine;silylsilane has a molecular weight of 121.33 g/mol, XLogP of -2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;silylsilane is sourced from PubChem (CID 172757602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).