C17H9Cl4F3O2 — CID 172760298
3-chloro-2-[(E)-4,4,4-trifluoro-1-(3,4,5-trichlorophenyl)but-1-enyl]benzoic acid (PubChem CID 172760298) has the molecular formula C17H9Cl4F3O2 and a molecular weight of 444.06 g/mol. Its IUPAC name is 3-chloro-2-[(E)-4,4,4-trifluoro-1-(3,4,5-trichlorophenyl)but-1-enyl]benzoic acid.
| Compound Name | 3-chloro-2-[(E)-4,4,4-trifluoro-1-(3,4,5-trichlorophenyl)but-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 172760298 |
| Molecular Formula | C17H9Cl4F3O2 |
| Molecular Weight | 444.06 g/mol |
| Exact Mass | 441.93 |
| IUPAC Name | 3-chloro-2-[(E)-4,4,4-trifluoro-1-(3,4,5-trichlorophenyl)but-1-enyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1/C(=C/CC(F)(F)F)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl4F3O2/c18-11-3-1-2-10(16(25)26)14(11)9(4-5-17(22,23)24)8-6-12(19)15(21)13(20)7-8/h1-4,6-7H,5H2,(H,25,26)/b9-4+ |
| InChIKey | LPCBJZLAIXPWMW-RUDMXATFSA-N |
| XLogP | 7.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|