C19H16N4OS — CID 172760721
[1-(1,3-benzothiazol-2-yl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]cyanamide (PubChem CID 172760721) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]cyanamide.
| Compound Name | [1-(1,3-benzothiazol-2-yl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]cyanamide |
|---|---|
| PubChem CID | 172760721 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)-2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]cyanamide |
| SMILES | N#CNC(C(=O)N1CCCc2ccccc21)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H16N4OS/c20-12-21-17(18-22-14-8-2-4-10-16(14)25-18)19(24)23-11-5-7-13-6-1-3-9-15(13)23/h1-4,6,8-10,17,21H,5,7,11H2 |
| InChIKey | LQMDYSUJCMUWGC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|