C21H16F4N4O3 — CID 172760744
N-(3-cyano-4-fluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]amino]acetyl]pyrrole-2-carboxamide (PubChem CID 172760744) has the molecular formula C21H16F4N4O3 and a molecular weight of 448.38 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]amino]acetyl]pyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]amino]acetyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 172760744 |
| Molecular Formula | C21H16F4N4O3 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-[[(2R)-1,1,1-trifluorobut-3-yn-2-yl]amino]acetyl]pyrrole-2-carboxamide |
| SMILES | C#C[C@@H](NC(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(C#N)c2)n(C)c1C)C(F)(F)F |
| InChI | InChI=1S/C21H16F4N4O3/c1-5-15(21(23,24)25)28-20(32)18(30)16-10(2)17(29(4)11(16)3)19(31)27-13-6-7-14(22)12(8-13)9-26/h1,6-8,15H,2-4H3,(H,27,31)(H,28,32)/t15-/m1/s1 |
| InChIKey | LQOJVXLHGXEYSQ-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|