C9H12ClN3O — CID 17276170
1-(5-chloro-2-pyridinyl)-3-propylurea (PubChem CID 17276170) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-3-propylurea.
| Compound Name | 1-(5-chloro-2-pyridinyl)-3-propylurea |
|---|---|
| PubChem CID | 17276170 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C9H12ClN3O/c1-2-5-11-9(14)13-8-4-3-7(10)6-12-8/h3-4,6H,2,5H2,1H3,(H2,11,12,13,14) |
| InChIKey | YZBNWJAXJFZSNH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |