About but-1-enyl acetate;hydrofluoride
but-1-enyl acetate;hydrofluoride (PubChem CID 172761898) has the molecular formula C6H11FO2
and a molecular weight of 134.15 g/mol. Its IUPAC name is but-1-enyl acetate;hydrofluoride.
Molecular Properties
| Compound Name | but-1-enyl acetate;hydrofluoride |
| PubChem CID | 172761898 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | but-1-enyl acetate;hydrofluoride |
| SMILES | CCC=COC(C)=O.F |
| InChI | InChI=1S/C6H10O2.FH/c1-3-4-5-8-6(2)7;/h4-5H,3H2,1-2H3;1H |
| InChIKey | LUKLJRBGZHDDBM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze but-1-enyl acetate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-enyl acetate;hydrofluoride?
The IUPAC name of but-1-enyl acetate;hydrofluoride (CID 172761898) is but-1-enyl acetate;hydrofluoride.
What is the SMILES notation for but-1-enyl acetate;hydrofluoride?
The canonical SMILES for but-1-enyl acetate;hydrofluoride is CCC=COC(C)=O.F.
What is the InChIKey of but-1-enyl acetate;hydrofluoride?
The InChIKey is LUKLJRBGZHDDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.FH/c1-3-4-5-8-6(2)7;/h4-5H,3H2,1-2H3;1H.
What are the key properties of but-1-enyl acetate;hydrofluoride?
but-1-enyl acetate;hydrofluoride has a molecular weight of 134.15 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-enyl acetate;hydrofluoride is sourced from PubChem (CID 172761898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).