heptadecylphosphanylmethoxyboronic acid

C18H40BO3P — CID 172762167

IUPACheptadecylphosphanylmethoxyboronic acid
SMILESCCCCCCCCCCCCCCCCCPCOB(O)O
InChIInChI=1S/C18H40BO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-18-22-19(20)21/h20-21,23H,2-18H2,1H3
InChIKeyLVHNVLBZEJDAHS-UHFFFAOYSA-N
MW346.30 g/mol
LogP5.48
Rot. Bonds19

About heptadecylphosphanylmethoxyboronic acid

heptadecylphosphanylmethoxyboronic acid (PubChem CID 172762167) has the molecular formula C18H40BO3P and a molecular weight of 346.30 g/mol. Its IUPAC name is heptadecylphosphanylmethoxyboronic acid.

Molecular Properties

Compound Nameheptadecylphosphanylmethoxyboronic acid
PubChem CID172762167
Molecular FormulaC18H40BO3P
Molecular Weight346.30 g/mol
Exact Mass346.28
IUPAC Nameheptadecylphosphanylmethoxyboronic acid
SMILESCCCCCCCCCCCCCCCCCPCOB(O)O
InChIInChI=1S/C18H40BO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-18-22-19(20)21/h20-21,23H,2-18H2,1H3
InChIKeyLVHNVLBZEJDAHS-UHFFFAOYSA-N
XLogP5.48
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds19
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500346.30
LogP ≤ 55.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze heptadecylphosphanylmethoxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of heptadecylphosphanylmethoxyboronic acid?
The IUPAC name of heptadecylphosphanylmethoxyboronic acid (CID 172762167) is heptadecylphosphanylmethoxyboronic acid.
What is the SMILES notation for heptadecylphosphanylmethoxyboronic acid?
The canonical SMILES for heptadecylphosphanylmethoxyboronic acid is CCCCCCCCCCCCCCCCCPCOB(O)O.
What is the InChIKey of heptadecylphosphanylmethoxyboronic acid?
The InChIKey is LVHNVLBZEJDAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40BO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-18-22-19(20)21/h20-21,23H,2-18H2,1H3.
What are the key properties of heptadecylphosphanylmethoxyboronic acid?
heptadecylphosphanylmethoxyboronic acid has a molecular weight of 346.30 g/mol, XLogP of 5.48, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecylphosphanylmethoxyboronic acid is sourced from PubChem (CID 172762167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).