About methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate
methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 172762744) has the molecular formula C9H10ClIO4
and a molecular weight of 344.53 g/mol. Its IUPAC name is methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 172762744 |
| Molecular Formula | C9H10ClIO4 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(Cl)CC(OC)(OI)C=C1 |
| InChI | InChI=1S/C9H10ClIO4/c1-13-8(12)6-3-4-9(14-2,15-11)5-7(6)10/h3-4H,5H2,1-2H3 |
| InChIKey | LXFVWRZUJVKVTI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate (CID 172762744) is methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=C(Cl)CC(OC)(OI)C=C1.
What is the InChIKey of methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is LXFVWRZUJVKVTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClIO4/c1-13-8(12)6-3-4-9(14-2,15-11)5-7(6)10/h3-4H,5H2,1-2H3.
What are the key properties of methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate?
methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 344.53 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-4-iodooxy-4-methoxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 172762744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).