C19H26O3 — CID 172763809
(2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 172763809) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 172763809 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl) 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(OC(=O)C2CC3C=CC2C3=O)CCC2CCCCC2C1 |
| InChI | InChI=1S/C19H26O3/c1-19(9-8-12-4-2-3-5-14(12)11-19)22-18(21)16-10-13-6-7-15(16)17(13)20/h6-7,12-16H,2-5,8-11H2,1H3 |
| InChIKey | MAUSVIOXHNMQNQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|