C14H12O4S2 — CID 172764103
4-(4-acetylphenyl)sulfanylbenzenesulfonic acid (PubChem CID 172764103) has the molecular formula C14H12O4S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(4-acetylphenyl)sulfanylbenzenesulfonic acid.
| Compound Name | 4-(4-acetylphenyl)sulfanylbenzenesulfonic acid |
|---|---|
| PubChem CID | 172764103 |
| Molecular Formula | C14H12O4S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-(4-acetylphenyl)sulfanylbenzenesulfonic acid |
| SMILES | CC(=O)c1ccc(Sc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H12O4S2/c1-10(15)11-2-4-12(5-3-11)19-13-6-8-14(9-7-13)20(16,17)18/h2-9H,1H3,(H,16,17,18) |
| InChIKey | MBSYWJWAWAECQO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|