About tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate
tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate (PubChem CID 172764186) has the molecular formula C20H27Cl2FN2O2
and a molecular weight of 417.35 g/mol. Its IUPAC name is tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate |
| PubChem CID | 172764186 |
| Molecular Formula | C20H27Cl2FN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate |
| SMILES | CC(C)(CC/C(F)=C/CNC(=O)OC(C)(C)C)/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H27Cl2FN2O2/c1-19(2,3)27-18(26)24-11-9-16(23)8-10-20(4,5)25-13-14-6-7-15(21)12-17(14)22/h6-7,9,12-13H,8,10-11H2,1-5H3,(H,24,26)/b16-9-,25-13+ |
| InChIKey | MCADAUXSVSUWFA-XQWKVNDMSA-N |
| XLogP | 6.35 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate?
The IUPAC name of tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate (CID 172764186) is tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate.
What is the SMILES notation for tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate?
The canonical SMILES for tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate is CC(C)(CC/C(F)=C/CNC(=O)OC(C)(C)C)/N=C/c1ccc(Cl)cc1Cl.
What is the InChIKey of tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate?
The InChIKey is MCADAUXSVSUWFA-XQWKVNDMSA-N. The full InChI is InChI=1S/C20H27Cl2FN2O2/c1-19(2,3)27-18(26)24-11-9-16(23)8-10-20(4,5)25-13-14-6-7-15(21)12-17(14)22/h6-7,9,12-13H,8,10-11H2,1-5H3,(H,24,26)/b16-9-,25-13+.
What are the key properties of tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate?
tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate has a molecular weight of 417.35 g/mol, XLogP of 6.35, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-6-[(2,4-dichlorophenyl)methylideneamino]-3-fluoro-6-methylhept-2-enyl]carbamate is sourced from PubChem (CID 172764186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).