About 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one
5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one (PubChem CID 172764217) has the molecular formula C11H9BrO4
and a molecular weight of 285.09 g/mol. Its IUPAC name is 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one.
Molecular Properties
| Compound Name | 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one |
| PubChem CID | 172764217 |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one |
| SMILES | O=C1OC2(COCOC2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H9BrO4/c12-7-1-2-8-9(3-7)11(16-10(8)13)4-14-6-15-5-11/h1-3H,4-6H2 |
| InChIKey | MCCGIFJYKOBGSE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one?
The IUPAC name of 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one (CID 172764217) is 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one.
What is the SMILES notation for 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one?
The canonical SMILES for 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one is O=C1OC2(COCOC2)c2cc(Br)ccc21.
What is the InChIKey of 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one?
The InChIKey is MCCGIFJYKOBGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO4/c12-7-1-2-8-9(3-7)11(16-10(8)13)4-14-6-15-5-11/h1-3H,4-6H2.
What are the key properties of 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one?
5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one has a molecular weight of 285.09 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-bromospiro[1,3-dioxane-5,3'-2-benzofuran]-1'-one is sourced from PubChem (CID 172764217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).