C19H22N2 — CID 172764261
N-(2-methylphenyl)-N'-(2,3,4,5,6-pentamethylphenyl)methanediimine (PubChem CID 172764261) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(2-methylphenyl)-N'-(2,3,4,5,6-pentamethylphenyl)methanediimine.
| Compound Name | N-(2-methylphenyl)-N'-(2,3,4,5,6-pentamethylphenyl)methanediimine |
|---|---|
| PubChem CID | 172764261 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-(2-methylphenyl)-N'-(2,3,4,5,6-pentamethylphenyl)methanediimine |
| SMILES | Cc1ccccc1N=C=Nc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C19H22N2/c1-12-9-7-8-10-18(12)20-11-21-19-16(5)14(3)13(2)15(4)17(19)6/h7-10H,1-6H3 |
| InChIKey | MCGDPKQJRBXLEQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|