C12H10F5NSSe — CID 172764370
1,2,3,4,5-pentafluoro-6-(5-isoselenocyanatopentylsulfanyl)benzene (PubChem CID 172764370) has the molecular formula C12H10F5NSSe and a molecular weight of 374.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(5-isoselenocyanatopentylsulfanyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(5-isoselenocyanatopentylsulfanyl)benzene |
|---|---|
| PubChem CID | 172764370 |
| Molecular Formula | C12H10F5NSSe |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(5-isoselenocyanatopentylsulfanyl)benzene |
| SMILES | Fc1c(F)c(F)c(SCCCCCN=C=[Se])c(F)c1F |
| InChI | InChI=1S/C12H10F5NSSe/c13-7-8(14)10(16)12(11(17)9(7)15)19-5-3-1-2-4-18-6-20/h1-5H2 |
| InChIKey | MCPHFDZXFQPAIQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|