About CID 172764488
CID 172764488 (PubChem CID 172764488) has the molecular formula C5H6NaO4
and a molecular weight of 153.09 g/mol.
Molecular Properties
| Compound Name | CID 172764488 |
| PubChem CID | 172764488 |
| Molecular Formula | C5H6NaO4 |
| Molecular Weight | 153.09 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | — |
| SMILES | CC1OC(=O)C(O)=C1O.[Na] |
| InChI | InChI=1S/C5H6O4.Na/c1-2-3(6)4(7)5(8)9-2;/h2,6-7H,1H3; |
| InChIKey | MCZLFEOGFYNRPJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.09 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 172764488 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172764488?
The IUPAC name of CID 172764488 (CID 172764488) is not available.
What is the SMILES notation for CID 172764488?
The canonical SMILES for CID 172764488 is CC1OC(=O)C(O)=C1O.[Na].
What is the InChIKey of CID 172764488?
The InChIKey is MCZLFEOGFYNRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.Na/c1-2-3(6)4(7)5(8)9-2;/h2,6-7H,1H3;.
What are the key properties of CID 172764488?
CID 172764488 has a molecular weight of 153.09 g/mol, XLogP of -0.12, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172764488 is sourced from PubChem (CID 172764488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).