About butanamide;cyanocyanamide
butanamide;cyanocyanamide (PubChem CID 172764946) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is butanamide;cyanocyanamide.
Molecular Properties
| Compound Name | butanamide;cyanocyanamide |
| PubChem CID | 172764946 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | butanamide;cyanocyanamide |
| SMILES | CCCC(N)=O.N#CNC#N |
| InChI | InChI=1S/C4H9NO.C2HN3/c1-2-3-4(5)6;3-1-5-2-4/h2-3H2,1H3,(H2,5,6);5H |
| InChIKey | MENJTZKDWLZZJG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze butanamide;cyanocyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;cyanocyanamide?
The IUPAC name of butanamide;cyanocyanamide (CID 172764946) is butanamide;cyanocyanamide.
What is the SMILES notation for butanamide;cyanocyanamide?
The canonical SMILES for butanamide;cyanocyanamide is CCCC(N)=O.N#CNC#N.
What is the InChIKey of butanamide;cyanocyanamide?
The InChIKey is MENJTZKDWLZZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C2HN3/c1-2-3-4(5)6;3-1-5-2-4/h2-3H2,1H3,(H2,5,6);5H.
What are the key properties of butanamide;cyanocyanamide?
butanamide;cyanocyanamide has a molecular weight of 154.17 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;cyanocyanamide is sourced from PubChem (CID 172764946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).