C15H15F2N3O4 — CID 172764976
3-cyano-5-(1,3-dioxolan-2-yl)-2,4-difluoro-N-hydroxy-N'-[(1-hydroxycyclopropyl)methyl]benzenecarboximidamide (PubChem CID 172764976) has the molecular formula C15H15F2N3O4 and a molecular weight of 339.30 g/mol. Its IUPAC name is 3-cyano-5-(1,3-dioxolan-2-yl)-2,4-difluoro-N-hydroxy-N'-[(1-hydroxycyclopropyl)methyl]benzenecarboximidamide.
| Compound Name | 3-cyano-5-(1,3-dioxolan-2-yl)-2,4-difluoro-N-hydroxy-N'-[(1-hydroxycyclopropyl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 172764976 |
| Molecular Formula | C15H15F2N3O4 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-cyano-5-(1,3-dioxolan-2-yl)-2,4-difluoro-N-hydroxy-N'-[(1-hydroxycyclopropyl)methyl]benzenecarboximidamide |
| SMILES | N#Cc1c(F)c(/C(=N/CC2(O)CC2)NO)cc(C2OCCO2)c1F |
| InChI | InChI=1S/C15H15F2N3O4/c16-11-8(13(20-22)19-7-15(21)1-2-15)5-9(12(17)10(11)6-18)14-23-3-4-24-14/h5,14,21-22H,1-4,7H2,(H,19,20) |
| InChIKey | MEPYULJDZJJHLC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|