C18H21BF2N2O5S — CID 172765913
2,4-difluoro-N-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide (PubChem CID 172765913) has the molecular formula C18H21BF2N2O5S and a molecular weight of 426.25 g/mol. Its IUPAC name is 2,4-difluoro-N-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 172765913 |
| Molecular Formula | C18H21BF2N2O5S |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2,4-difluoro-N-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cnc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H21BF2N2O5S/c1-17(2)18(3,4)28-19(27-17)11-8-14(26-5)16(22-10-11)23-29(24,25)15-7-6-12(20)9-13(15)21/h6-10H,1-5H3,(H,22,23) |
| InChIKey | MHRGRKHCXWDBRF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|