About 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene
4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene (PubChem CID 172766932) has the molecular formula C16H21FO2
and a molecular weight of 264.34 g/mol. Its IUPAC name is 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene.
Molecular Properties
| Compound Name | 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene |
| PubChem CID | 172766932 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(/C=C(\F)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C16H21FO2/c1-18-15-9-8-12(11-16(15)19-2)10-14(17)13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3/b14-10- |
| InChIKey | MKYSRBSXGITPRF-UVTDQMKNSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene?
The IUPAC name of 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene (CID 172766932) is 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene.
What is the SMILES notation for 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene?
The canonical SMILES for 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene is COc1ccc(/C=C(\F)C2CCCCC2)cc1OC.
What is the InChIKey of 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene?
The InChIKey is MKYSRBSXGITPRF-UVTDQMKNSA-N. The full InChI is InChI=1S/C16H21FO2/c1-18-15-9-8-12(11-16(15)19-2)10-14(17)13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3/b14-10-.
What are the key properties of 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene?
4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene has a molecular weight of 264.34 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2-cyclohexyl-2-fluoroethenyl]-1,2-dimethoxybenzene is sourced from PubChem (CID 172766932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).