About 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one
4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one (PubChem CID 172768035) has the molecular formula C7H8N6O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one.
Molecular Properties
| Compound Name | 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one |
| PubChem CID | 172768035 |
| Molecular Formula | C7H8N6O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one |
| SMILES | [H]/N=C1\N=C(N)C2N=C(C)C(=O)NC2=N1 |
| InChI | InChI=1S/C7H8N6O/c1-2-6(14)12-5-3(10-2)4(8)11-7(9)13-5/h3H,1H3,(H4,8,9,11,12,13,14) |
| InChIKey | MORJFTYJKMBWTH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one?
The IUPAC name of 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one (CID 172768035) is 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one.
What is the SMILES notation for 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one?
The canonical SMILES for 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one is [H]/N=C1\N=C(N)C2N=C(C)C(=O)NC2=N1.
What is the InChIKey of 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one?
The InChIKey is MORJFTYJKMBWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6O/c1-2-6(14)12-5-3(10-2)4(8)11-7(9)13-5/h3H,1H3,(H4,8,9,11,12,13,14).
What are the key properties of 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one?
4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one has a molecular weight of 192.18 g/mol, XLogP of -1.35, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-imino-6-methyl-4a,8-dihydropteridin-7-one is sourced from PubChem (CID 172768035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).