C20H23BFN3O3 — CID 172768132
2-[2-amino-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 172768132) has the molecular formula C20H23BFN3O3 and a molecular weight of 383.23 g/mol. Its IUPAC name is 2-[2-amino-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[2-amino-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 172768132 |
| Molecular Formula | C20H23BFN3O3 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[2-amino-6-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CC1(C)OB(c2cc(N3CCc4ccccc4C3=O)c(N)nc2F)OC1(C)C |
| InChI | InChI=1S/C20H23BFN3O3/c1-19(2)20(3,4)28-21(27-19)14-11-15(17(23)24-16(14)22)25-10-9-12-7-5-6-8-13(12)18(25)26/h5-8,11H,9-10H2,1-4H3,(H2,23,24) |
| InChIKey | MOZVVQXOFSFKRS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|