About 2-oxoimidazolidine-1,3-disulfonic acid
2-oxoimidazolidine-1,3-disulfonic acid (PubChem CID 172768243) has the molecular formula C3H6N2O7S2
and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-oxoimidazolidine-1,3-disulfonic acid.
Molecular Properties
| Compound Name | 2-oxoimidazolidine-1,3-disulfonic acid |
| PubChem CID | 172768243 |
| Molecular Formula | C3H6N2O7S2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 2-oxoimidazolidine-1,3-disulfonic acid |
| SMILES | O=C1N(S(=O)(=O)O)CCN1S(=O)(=O)O |
| InChI | InChI=1S/C3H6N2O7S2/c6-3-4(13(7,8)9)1-2-5(3)14(10,11)12/h1-2H2,(H,7,8,9)(H,10,11,12) |
| InChIKey | MPIVOAMRSBJLFV-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoimidazolidine-1,3-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoimidazolidine-1,3-disulfonic acid?
The IUPAC name of 2-oxoimidazolidine-1,3-disulfonic acid (CID 172768243) is 2-oxoimidazolidine-1,3-disulfonic acid.
What is the SMILES notation for 2-oxoimidazolidine-1,3-disulfonic acid?
The canonical SMILES for 2-oxoimidazolidine-1,3-disulfonic acid is O=C1N(S(=O)(=O)O)CCN1S(=O)(=O)O.
What is the InChIKey of 2-oxoimidazolidine-1,3-disulfonic acid?
The InChIKey is MPIVOAMRSBJLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O7S2/c6-3-4(13(7,8)9)1-2-5(3)14(10,11)12/h1-2H2,(H,7,8,9)(H,10,11,12).
What are the key properties of 2-oxoimidazolidine-1,3-disulfonic acid?
2-oxoimidazolidine-1,3-disulfonic acid has a molecular weight of 246.22 g/mol, XLogP of -1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoimidazolidine-1,3-disulfonic acid is sourced from PubChem (CID 172768243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).