About 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride
3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride (PubChem CID 172768497) has the molecular formula C7H14F2O4S
and a molecular weight of 232.25 g/mol. Its IUPAC name is 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride.
Molecular Properties
| Compound Name | 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride |
| PubChem CID | 172768497 |
| Molecular Formula | C7H14F2O4S |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride |
| SMILES | C=COCCC(OCC)S(=O)(=O)F.F |
| InChI | InChI=1S/C7H13FO4S.FH/c1-3-11-6-5-7(12-4-2)13(8,9)10;/h3,7H,1,4-6H2,2H3;1H |
| InChIKey | MQFJCGLNUVCUIP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride?
The IUPAC name of 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride (CID 172768497) is 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride.
What is the SMILES notation for 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride?
The canonical SMILES for 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride is C=COCCC(OCC)S(=O)(=O)F.F.
What is the InChIKey of 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride?
The InChIKey is MQFJCGLNUVCUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO4S.FH/c1-3-11-6-5-7(12-4-2)13(8,9)10;/h3,7H,1,4-6H2,2H3;1H.
What are the key properties of 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride?
3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride has a molecular weight of 232.25 g/mol, XLogP of 1.35, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxy-1-ethoxypropane-1-sulfonyl fluoride;hydrofluoride is sourced from PubChem (CID 172768497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).