About imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride
imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride (PubChem CID 172768799) has the molecular formula C10H9Cl2N3S
and a molecular weight of 274.18 g/mol. Its IUPAC name is imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride.
Molecular Properties
| Compound Name | imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride |
| PubChem CID | 172768799 |
| Molecular Formula | C10H9Cl2N3S |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride |
| SMILES | C1=Nc2ccccc2Sc2nccn21.Cl.Cl |
| InChI | InChI=1S/C10H7N3S.2ClH/c1-2-4-9-8(3-1)12-7-13-6-5-11-10(13)14-9;;/h1-7H;2*1H |
| InChIKey | MRBXDUSCSNRJDD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride?
The IUPAC name of imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride (CID 172768799) is imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride.
What is the SMILES notation for imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride?
The canonical SMILES for imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride is C1=Nc2ccccc2Sc2nccn21.Cl.Cl.
What is the InChIKey of imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride?
The InChIKey is MRBXDUSCSNRJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3S.2ClH/c1-2-4-9-8(3-1)12-7-13-6-5-11-10(13)14-9;;/h1-7H;2*1H.
What are the key properties of imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride?
imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride has a molecular weight of 274.18 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[2,1-b][1,3,5]benzothiadiazepine;dihydrochloride is sourced from PubChem (CID 172768799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).