About 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea
1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 17276890) has the molecular formula C12H26N2S
and a molecular weight of 230.42 g/mol. Its IUPAC name is 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| PubChem CID | 17276890 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)NC(=S)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H26N2S/c1-9(2)13-10(15)14-12(6,7)8-11(3,4)5/h9H,8H2,1-7H3,(H2,13,14,15) |
| InChIKey | OWEAIUDWIDYSAR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea?
The IUPAC name of 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea (CID 17276890) is 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea.
What is the SMILES notation for 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea?
The canonical SMILES for 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea is CC(C)NC(=S)NC(C)(C)CC(C)(C)C.
What is the InChIKey of 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea?
The InChIKey is OWEAIUDWIDYSAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2S/c1-9(2)13-10(15)14-12(6,7)8-11(3,4)5/h9H,8H2,1-7H3,(H2,13,14,15).
What are the key properties of 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea?
1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea has a molecular weight of 230.42 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)thiourea is sourced from PubChem (CID 17276890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).