C34H52O5 — CID 172769767
(2E,4E,6E,8E,10E,13S)-13-hydroxy-4,6,10-trimethyl-2-[(6S,7S,9E,12R)-7-methyl-2-oxo-12-propan-2-yl-1-oxacyclododec-9-en-6-yl]hexadeca-2,4,6,8,10-pentaenoic acid (PubChem CID 172769767) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,13S)-13-hydroxy-4,6,10-trimethyl-2-[(6S,7S,9E,12R)-7-methyl-2-oxo-12-propan-2-yl-1-oxacyclododec-9-en-6-yl]hexadeca-2,4,6,8,10-pentaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E,13S)-13-hydroxy-4,6,10-trimethyl-2-[(6S,7S,9E,12R)-7-methyl-2-oxo-12-propan-2-yl-1-oxacyclododec-9-en-6-yl]hexadeca-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 172769767 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | (2E,4E,6E,8E,10E,13S)-13-hydroxy-4,6,10-trimethyl-2-[(6S,7S,9E,12R)-7-methyl-2-oxo-12-propan-2-yl-1-oxacyclododec-9-en-6-yl]hexadeca-2,4,6,8,10-pentaenoic acid |
| SMILES | CCC[C@H](O)C/C=C(C)/C=C/C=C(C)/C=C(C)/C=C(/C(=O)O)[C@H]1CCCC(=O)O[C@@H](C(C)C)C/C=C/C[C@@H]1C |
| InChI | InChI=1S/C34H52O5/c1-8-13-29(35)21-20-25(4)14-11-15-26(5)22-27(6)23-31(34(37)38)30-17-12-19-33(36)39-32(24(2)3)18-10-9-16-28(30)7/h9-11,14-15,20,22-24,28-30,32,35H,8,12-13,16-19,21H2,1-7H3,(H,37,38)/b10-9+,14-11+,25-20+,26-15+,27-22+,31-23+/t28-,29-,30-,32+/m0/s1 |
| InChIKey | MUKKFYJMDYVTCW-OTIUAPCNSA-N |
| XLogP | 8.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|