C19H21N3O3 — CID 172771308
[2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate (PubChem CID 172771308) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is [2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate.
| Compound Name | [2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 172771308 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate |
| SMILES | CC(=O)OCc1cccnc1N1CCn2c(cc3c2CCCC3)C1=O |
| InChI | InChI=1S/C19H21N3O3/c1-13(23)25-12-15-6-4-8-20-18(15)22-10-9-21-16-7-3-2-5-14(16)11-17(21)19(22)24/h4,6,8,11H,2-3,5,7,9-10,12H2,1H3 |
| InChIKey | MZIJWBYJNGNYEZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |