About CID 172771963
CID 172771963 (PubChem CID 172771963) has the molecular formula C11H19LiNO
and a molecular weight of 188.22 g/mol.
Molecular Properties
| Compound Name | CID 172771963 |
| PubChem CID | 172771963 |
| Molecular Formula | C11H19LiNO |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | — |
| SMILES | CC(C)C1=C(C(C)C)C(N)OC=C1.[Li] |
| InChI | InChI=1S/C11H19NO.Li/c1-7(2)9-5-6-13-11(12)10(9)8(3)4;/h5-8,11H,12H2,1-4H3; |
| InChIKey | NBRLRYCHKIWQGY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 172771963 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172771963?
The IUPAC name of CID 172771963 (CID 172771963) is not available.
What is the SMILES notation for CID 172771963?
The canonical SMILES for CID 172771963 is CC(C)C1=C(C(C)C)C(N)OC=C1.[Li].
What is the InChIKey of CID 172771963?
The InChIKey is NBRLRYCHKIWQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO.Li/c1-7(2)9-5-6-13-11(12)10(9)8(3)4;/h5-8,11H,12H2,1-4H3;.
What are the key properties of CID 172771963?
CID 172771963 has a molecular weight of 188.22 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172771963 is sourced from PubChem (CID 172771963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).