C11H14ClN3 — CID 172772412
3-[2-(2-chlorophenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazine (PubChem CID 172772412) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazine.
| Compound Name | 3-[2-(2-chlorophenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 172772412 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethyl]-2,4-dihydro-1H-1,3,5-triazine |
| SMILES | Clc1ccccc1CCN1CN=CNC1 |
| InChI | InChI=1S/C11H14ClN3/c12-11-4-2-1-3-10(11)5-6-15-8-13-7-14-9-15/h1-4,7H,5-6,8-9H2,(H,13,14) |
| InChIKey | NDEZBCSYDAJMIF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |