C20H28BN5O4 — CID 172772487
3-[(5-acetyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 172772487) has the molecular formula C20H28BN5O4 and a molecular weight of 413.29 g/mol. Its IUPAC name is 3-[(5-acetyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 3-[(5-acetyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 172772487 |
| Molecular Formula | C20H28BN5O4 |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3-[(5-acetyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-4-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | CC(=O)N1CCn2nc(Nc3c(C)ccn(B4OC(C)(C)C(C)(C)O4)c3=O)cc2C1 |
| InChI | InChI=1S/C20H28BN5O4/c1-13-7-8-25(21-29-19(3,4)20(5,6)30-21)18(28)17(13)22-16-11-15-12-24(14(2)27)9-10-26(15)23-16/h7-8,11H,9-10,12H2,1-6H3,(H,22,23) |
| InChIKey | NDMGABWAGRAISH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|