C54H40BF5O3P2S2 — CID 172772718
bis(diphenyl-(4-phenylsulfanylphenyl)phosphane);(2,3,4,5,6-pentafluorophenoxy)boronic acid (PubChem CID 172772718) has the molecular formula C54H40BF5O3P2S2 and a molecular weight of 968.80 g/mol. Its IUPAC name is bis(diphenyl-(4-phenylsulfanylphenyl)phosphane);(2,3,4,5,6-pentafluorophenoxy)boronic acid.
| Compound Name | bis(diphenyl-(4-phenylsulfanylphenyl)phosphane);(2,3,4,5,6-pentafluorophenoxy)boronic acid |
|---|---|
| PubChem CID | 172772718 |
| Molecular Formula | C54H40BF5O3P2S2 |
| Molecular Weight | 968.80 g/mol |
| Exact Mass | 968.19 |
| IUPAC Name | bis(diphenyl-(4-phenylsulfanylphenyl)phosphane);(2,3,4,5,6-pentafluorophenoxy)boronic acid |
| SMILES | OB(O)Oc1c(F)c(F)c(F)c(F)c1F.c1ccc(Sc2ccc(P(c3ccccc3)c3ccccc3)cc2)cc1.c1ccc(Sc2ccc(P(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/2C24H19PS.C6H2BF5O3/c2*1-4-10-20(11-5-1)25(21-12-6-2-7-13-21)22-16-18-24(19-17-22)26-23-14-8-3-9-15-23;8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h2*1-19H;13-14H |
| InChIKey | NEGNGGOAMNSRKC-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.80 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|