About 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol
3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol (PubChem CID 172775086) has the molecular formula C18H17F3N4O
and a molecular weight of 362.36 g/mol. Its IUPAC name is 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol.
Molecular Properties
| Compound Name | 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol |
| PubChem CID | 172775086 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol |
| SMILES | Cc1ccc(O)c(C)c1-n1c(N)cc2nc(C3(C(F)(F)F)CC3)cnc21 |
| InChI | InChI=1S/C18H17F3N4O/c1-9-3-4-12(26)10(2)15(9)25-14(22)7-11-16(25)23-8-13(24-11)17(5-6-17)18(19,20)21/h3-4,7-8,26H,5-6,22H2,1-2H3 |
| InChIKey | NMCYQGGQYZDKBN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol?
The IUPAC name of 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol (CID 172775086) is 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol.
What is the SMILES notation for 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol?
The canonical SMILES for 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol is Cc1ccc(O)c(C)c1-n1c(N)cc2nc(C3(C(F)(F)F)CC3)cnc21.
What is the InChIKey of 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol?
The InChIKey is NMCYQGGQYZDKBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N4O/c1-9-3-4-12(26)10(2)15(9)25-14(22)7-11-16(25)23-8-13(24-11)17(5-6-17)18(19,20)21/h3-4,7-8,26H,5-6,22H2,1-2H3.
What are the key properties of 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol?
3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol has a molecular weight of 362.36 g/mol, XLogP of 3.92, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-amino-2-[1-(trifluoromethyl)cyclopropyl]pyrrolo[2,3-b]pyrazin-5-yl]-2,4-dimethylphenol is sourced from PubChem (CID 172775086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).