About aniline;4-chloro-2,3-dimethylaniline
aniline;4-chloro-2,3-dimethylaniline (PubChem CID 172775905) has the molecular formula C14H17ClN2
and a molecular weight of 248.76 g/mol. Its IUPAC name is aniline;4-chloro-2,3-dimethylaniline.
Molecular Properties
| Compound Name | aniline;4-chloro-2,3-dimethylaniline |
| PubChem CID | 172775905 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | aniline;4-chloro-2,3-dimethylaniline |
| SMILES | Cc1c(N)ccc(Cl)c1C.Nc1ccccc1 |
| InChI | InChI=1S/C8H10ClN.C6H7N/c1-5-6(2)8(10)4-3-7(5)9;7-6-4-2-1-3-5-6/h3-4H,10H2,1-2H3;1-5H,7H2 |
| InChIKey | NOWYRZUSKVSMEQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;4-chloro-2,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;4-chloro-2,3-dimethylaniline?
The IUPAC name of aniline;4-chloro-2,3-dimethylaniline (CID 172775905) is aniline;4-chloro-2,3-dimethylaniline.
What is the SMILES notation for aniline;4-chloro-2,3-dimethylaniline?
The canonical SMILES for aniline;4-chloro-2,3-dimethylaniline is Cc1c(N)ccc(Cl)c1C.Nc1ccccc1.
What is the InChIKey of aniline;4-chloro-2,3-dimethylaniline?
The InChIKey is NOWYRZUSKVSMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN.C6H7N/c1-5-6(2)8(10)4-3-7(5)9;7-6-4-2-1-3-5-6/h3-4H,10H2,1-2H3;1-5H,7H2.
What are the key properties of aniline;4-chloro-2,3-dimethylaniline?
aniline;4-chloro-2,3-dimethylaniline has a molecular weight of 248.76 g/mol, XLogP of 3.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;4-chloro-2,3-dimethylaniline is sourced from PubChem (CID 172775905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).