About N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide
N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide (PubChem CID 172776453) has the molecular formula C12H18F2N4O
and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide |
| PubChem CID | 172776453 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide |
| SMILES | CCn1nnc(C)c1C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H18F2N4O/c1-3-18-10(8(2)16-17-18)11(19)15-9-4-6-12(13,14)7-5-9/h9H,3-7H2,1-2H3,(H,15,19) |
| InChIKey | NQTYDEFDKCEQFC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide?
The IUPAC name of N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide (CID 172776453) is N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide is CCn1nnc(C)c1C(=O)NC1CCC(F)(F)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide?
The InChIKey is NQTYDEFDKCEQFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N4O/c1-3-18-10(8(2)16-17-18)11(19)15-9-4-6-12(13,14)7-5-9/h9H,3-7H2,1-2H3,(H,15,19).
What are the key properties of N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide?
N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide has a molecular weight of 272.30 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-3-ethyl-5-methyltriazole-4-carboxamide is sourced from PubChem (CID 172776453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).