About 2H-phenanthridin-6-one
2H-phenanthridin-6-one (PubChem CID 172777064) has the molecular formula C13H9NO
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2H-phenanthridin-6-one.
Molecular Properties
| Compound Name | 2H-phenanthridin-6-one |
| PubChem CID | 172777064 |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2H-phenanthridin-6-one |
| SMILES | O=C1N=C2C=CCC=C2c2ccccc21 |
| InChI | InChI=1S/C13H9NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-2,4-8H,3H2 |
| InChIKey | NTASQBDNLBXVMJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-phenanthridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-phenanthridin-6-one?
The IUPAC name of 2H-phenanthridin-6-one (CID 172777064) is 2H-phenanthridin-6-one.
What is the SMILES notation for 2H-phenanthridin-6-one?
The canonical SMILES for 2H-phenanthridin-6-one is O=C1N=C2C=CCC=C2c2ccccc21.
What is the InChIKey of 2H-phenanthridin-6-one?
The InChIKey is NTASQBDNLBXVMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-2,4-8H,3H2.
What are the key properties of 2H-phenanthridin-6-one?
2H-phenanthridin-6-one has a molecular weight of 195.22 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-phenanthridin-6-one is sourced from PubChem (CID 172777064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).