About CID 172777676
CID 172777676 (PubChem CID 172777676) has the molecular formula C6H8NaOS
and a molecular weight of 151.19 g/mol.
Molecular Properties
| Compound Name | CID 172777676 |
| PubChem CID | 172777676 |
| Molecular Formula | C6H8NaOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | — |
| SMILES | Cc1ccsc1CO.[Na] |
| InChI | InChI=1S/C6H8OS.Na/c1-5-2-3-8-6(5)4-7;/h2-3,7H,4H2,1H3; |
| InChIKey | NVAWNSDBVGSKLU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 172777676 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172777676?
The IUPAC name of CID 172777676 (CID 172777676) is not available.
What is the SMILES notation for CID 172777676?
The canonical SMILES for CID 172777676 is Cc1ccsc1CO.[Na].
What is the InChIKey of CID 172777676?
The InChIKey is NVAWNSDBVGSKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS.Na/c1-5-2-3-8-6(5)4-7;/h2-3,7H,4H2,1H3;.
What are the key properties of CID 172777676?
CID 172777676 has a molecular weight of 151.19 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172777676 is sourced from PubChem (CID 172777676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).