About isocyanic acid;tributoxy(pentyl)silane
isocyanic acid;tributoxy(pentyl)silane (PubChem CID 172778190) has the molecular formula C18H39NO4Si
and a molecular weight of 361.60 g/mol. Its IUPAC name is isocyanic acid;tributoxy(pentyl)silane.
Molecular Properties
| Compound Name | isocyanic acid;tributoxy(pentyl)silane |
| PubChem CID | 172778190 |
| Molecular Formula | C18H39NO4Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | isocyanic acid;tributoxy(pentyl)silane |
| SMILES | CCCCC[Si](OCCCC)(OCCCC)OCCCC.N=C=O |
| InChI | InChI=1S/C17H38O3Si.CHNO/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;2-1-3/h5-17H2,1-4H3;2H |
| InChIKey | NWVHDXTXEYKBHI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;tributoxy(pentyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;tributoxy(pentyl)silane?
The IUPAC name of isocyanic acid;tributoxy(pentyl)silane (CID 172778190) is isocyanic acid;tributoxy(pentyl)silane.
What is the SMILES notation for isocyanic acid;tributoxy(pentyl)silane?
The canonical SMILES for isocyanic acid;tributoxy(pentyl)silane is CCCCC[Si](OCCCC)(OCCCC)OCCCC.N=C=O.
What is the InChIKey of isocyanic acid;tributoxy(pentyl)silane?
The InChIKey is NWVHDXTXEYKBHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38O3Si.CHNO/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;2-1-3/h5-17H2,1-4H3;2H.
What are the key properties of isocyanic acid;tributoxy(pentyl)silane?
isocyanic acid;tributoxy(pentyl)silane has a molecular weight of 361.60 g/mol, XLogP of 5.47, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;tributoxy(pentyl)silane is sourced from PubChem (CID 172778190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).