C16H17Cl3F2N2O2 — CID 172778348
2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine;hydrochloride (PubChem CID 172778348) has the molecular formula C16H17Cl3F2N2O2 and a molecular weight of 413.68 g/mol. Its IUPAC name is 2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine;hydrochloride.
| Compound Name | 2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 172778348 |
| Molecular Formula | C16H17Cl3F2N2O2 |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1cc(OC)c(F)c(C(N)Cc2cnc(Cl)c(C)c2Cl)c1F.Cl |
| InChI | InChI=1S/C16H16Cl2F2N2O2.ClH/c1-7-13(17)8(6-22-16(7)18)4-9(21)12-14(19)10(23-2)5-11(24-3)15(12)20;/h5-6,9H,4,21H2,1-3H3;1H |
| InChIKey | NXHUXCSTGNEGDN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|