C26H34N4O4S — CID 172778906
4-ethyl-N-(2-methylpropyl)aniline;4-hydroxy-1-(pyrimidin-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-sulfonic acid (PubChem CID 172778906) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-ethyl-N-(2-methylpropyl)aniline;4-hydroxy-1-(pyrimidin-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-sulfonic acid.
| Compound Name | 4-ethyl-N-(2-methylpropyl)aniline;4-hydroxy-1-(pyrimidin-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-sulfonic acid |
|---|---|
| PubChem CID | 172778906 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4-ethyl-N-(2-methylpropyl)aniline;4-hydroxy-1-(pyrimidin-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-sulfonic acid |
| SMILES | CCc1ccc(NCC(C)C)cc1.O=S(=O)(O)c1ccc2c(c1)C(O)CCN2Cc1ccncn1 |
| InChI | InChI=1S/C14H15N3O4S.C12H19N/c18-14-4-6-17(8-10-3-5-15-9-16-10)13-2-1-11(7-12(13)14)22(19,20)21;1-4-11-5-7-12(8-6-11)13-9-10(2)3/h1-3,5,7,9,14,18H,4,6,8H2,(H,19,20,21);5-8,10,13H,4,9H2,1-3H3 |
| InChIKey | NZGVCEFTWDLTPW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|