About 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile
3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile (PubChem CID 172781411) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile |
| PubChem CID | 172781411 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile |
| SMILES | N#CCCC1OCC2(COCOC2)CO1 |
| InChI | InChI=1S/C10H15NO4/c11-3-1-2-9-14-6-10(7-15-9)4-12-8-13-5-10/h9H,1-2,4-8H2 |
| InChIKey | OHSBUGYTIDVYAE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile?
The IUPAC name of 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile (CID 172781411) is 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile.
What is the SMILES notation for 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile?
The canonical SMILES for 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile is N#CCCC1OCC2(COCOC2)CO1.
What is the InChIKey of 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile?
The InChIKey is OHSBUGYTIDVYAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c11-3-1-2-9-14-6-10(7-15-9)4-12-8-13-5-10/h9H,1-2,4-8H2.
What are the key properties of 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile?
3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile has a molecular weight of 213.23 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propanenitrile is sourced from PubChem (CID 172781411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).