C33H35N5O5S — CID 172781448
ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[[1-(4-methyl-3-propan-2-ylphenyl)sulfonylindol-5-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 172781448) has the molecular formula C33H35N5O5S and a molecular weight of 613.74 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[[1-(4-methyl-3-propan-2-ylphenyl)sulfonylindol-5-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[[1-(4-methyl-3-propan-2-ylphenyl)sulfonylindol-5-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 172781448 |
| Molecular Formula | C33H35N5O5S |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dimethyl-4-[[1-(4-methyl-3-propan-2-ylphenyl)sulfonylindol-5-yl]methyl]phenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(C)c(Cc2ccc3c(ccn3S(=O)(=O)c3ccc(C)c(C(C)C)c3)c2)c(C)c1 |
| InChI | InChI=1S/C33H35N5O5S/c1-7-43-33(40)35-32(39)30(19-34)37-36-26-14-22(5)29(23(6)15-26)17-24-9-11-31-25(16-24)12-13-38(31)44(41,42)27-10-8-21(4)28(18-27)20(2)3/h8-16,18,20,36H,7,17H2,1-6H3,(H,35,39,40) |
| InChIKey | OHVBOTCPSVBUOA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|