About CID 172781519
CID 172781519 (PubChem CID 172781519) has the molecular formula C26H23ClFN3NaO4S
and a molecular weight of 551.00 g/mol.
Molecular Properties
| Compound Name | CID 172781519 |
| PubChem CID | 172781519 |
| Molecular Formula | C26H23ClFN3NaO4S |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | — |
| SMILES | CCc1nc(-c2ccc(F)cc2)cn1-c1ccc(CCOC(=O)NS(=O)(=O)c2ccccc2Cl)cc1.[Na] |
| InChI | InChI=1S/C26H23ClFN3O4S.Na/c1-2-25-29-23(19-9-11-20(28)12-10-19)17-31(25)21-13-7-18(8-14-21)15-16-35-26(32)30-36(33,34)24-6-4-3-5-22(24)27;/h3-14,17H,2,15-16H2,1H3,(H,30,32); |
| InChIKey | OIBGQBOHWJJMEG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 172781519 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172781519?
The IUPAC name of CID 172781519 (CID 172781519) is not available.
What is the SMILES notation for CID 172781519?
The canonical SMILES for CID 172781519 is CCc1nc(-c2ccc(F)cc2)cn1-c1ccc(CCOC(=O)NS(=O)(=O)c2ccccc2Cl)cc1.[Na].
What is the InChIKey of CID 172781519?
The InChIKey is OIBGQBOHWJJMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23ClFN3O4S.Na/c1-2-25-29-23(19-9-11-20(28)12-10-19)17-31(25)21-13-7-18(8-14-21)15-16-35-26(32)30-36(33,34)24-6-4-3-5-22(24)27;/h3-14,17H,2,15-16H2,1H3,(H,30,32);.
What are the key properties of CID 172781519?
CID 172781519 has a molecular weight of 551.00 g/mol, XLogP of 5.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172781519 is sourced from PubChem (CID 172781519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).