About 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride
5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride (PubChem CID 172782153) has the molecular formula C7H19Cl2N5
and a molecular weight of 244.17 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride |
| PubChem CID | 172782153 |
| Molecular Formula | C7H19Cl2N5 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride |
| SMILES | CC1C(N)=C(CCN)N(C)N1N.Cl.Cl |
| InChI | InChI=1S/C7H17N5.2ClH/c1-5-7(9)6(3-4-8)11(2)12(5)10;;/h5H,3-4,8-10H2,1-2H3;2*1H |
| InChIKey | OKDCWMYUGFAHRW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride?
The IUPAC name of 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride (CID 172782153) is 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride.
What is the SMILES notation for 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride?
The canonical SMILES for 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride is CC1C(N)=C(CCN)N(C)N1N.Cl.Cl.
What is the InChIKey of 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride?
The InChIKey is OKDCWMYUGFAHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N5.2ClH/c1-5-7(9)6(3-4-8)11(2)12(5)10;;/h5H,3-4,8-10H2,1-2H3;2*1H.
What are the key properties of 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride?
5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride has a molecular weight of 244.17 g/mol, XLogP of -0.23, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine;dihydrochloride is sourced from PubChem (CID 172782153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).