About (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile
(2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile (PubChem CID 172782755) has the molecular formula C15H16N4S
and a molecular weight of 284.39 g/mol. Its IUPAC name is (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile.
Molecular Properties
| Compound Name | (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile |
| PubChem CID | 172782755 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC[C@H]1CNc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H16N4S/c16-11-19-8-4-7-13(19)9-17-15-18-10-14(20-15)12-5-2-1-3-6-12/h1-3,5-6,10,13H,4,7-9H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | OMDVLUNPAQUVHI-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile?
The IUPAC name of (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile (CID 172782755) is (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile.
What is the SMILES notation for (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile?
The canonical SMILES for (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile is N#CN1CCC[C@H]1CNc1ncc(-c2ccccc2)s1.
What is the InChIKey of (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile?
The InChIKey is OMDVLUNPAQUVHI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H16N4S/c16-11-19-8-4-7-13(19)9-17-15-18-10-14(20-15)12-5-2-1-3-6-12/h1-3,5-6,10,13H,4,7-9H2,(H,17,18)/t13-/m0/s1.
What are the key properties of (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile?
(2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile has a molecular weight of 284.39 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(5-phenyl-1,3-thiazol-2-yl)amino]methyl]pyrrolidine-1-carbonitrile is sourced from PubChem (CID 172782755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).