About 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile
2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile (PubChem CID 172783261) has the molecular formula C9H6BrF2NS
and a molecular weight of 278.12 g/mol. Its IUPAC name is 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile.
Molecular Properties
| Compound Name | 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile |
| PubChem CID | 172783261 |
| Molecular Formula | C9H6BrF2NS |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile |
| SMILES | CC(C#N)Sc1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C9H6BrF2NS/c1-5(4-13)14-9-3-8(12)7(11)2-6(9)10/h2-3,5H,1H3 |
| InChIKey | ONUYAAXKDVYBEK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile?
The IUPAC name of 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile (CID 172783261) is 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile.
What is the SMILES notation for 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile?
The canonical SMILES for 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile is CC(C#N)Sc1cc(F)c(F)cc1Br.
What is the InChIKey of 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile?
The InChIKey is ONUYAAXKDVYBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF2NS/c1-5(4-13)14-9-3-8(12)7(11)2-6(9)10/h2-3,5H,1H3.
What are the key properties of 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile?
2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile has a molecular weight of 278.12 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-difluorophenyl)sulfanylpropanenitrile is sourced from PubChem (CID 172783261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).