C33H41BN6O3 — CID 172783315
2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide (PubChem CID 172783315) has the molecular formula C33H41BN6O3 and a molecular weight of 580.54 g/mol. Its IUPAC name is 2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide.
| Compound Name | 2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 172783315 |
| Molecular Formula | C33H41BN6O3 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(tritylamino)pentyl]tetrazol-1-yl]acetamide |
| SMILES | CC1(C)OB(CCCCC(NC(c2ccccc2)(c2ccccc2)c2ccccc2)c2nnnn2CC(N)=O)OC1(C)C |
| InChI | InChI=1S/C33H41BN6O3/c1-31(2)32(3,4)43-34(42-31)23-15-14-22-28(30-37-38-39-40(30)24-29(35)41)36-33(25-16-8-5-9-17-25,26-18-10-6-11-19-26)27-20-12-7-13-21-27/h5-13,16-21,28,36H,14-15,22-24H2,1-4H3,(H2,35,41) |
| InChIKey | OOAKFBIKNNGETH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|