C14H22N2O2 — CID 172783371
1-pentyl-4-pyrrol-1-ylpyrrolidine-2-carboxylic acid (PubChem CID 172783371) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-pentyl-4-pyrrol-1-ylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-pentyl-4-pyrrol-1-ylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 172783371 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-pentyl-4-pyrrol-1-ylpyrrolidine-2-carboxylic acid |
| SMILES | CCCCCN1CC(n2cccc2)CC1C(=O)O |
| InChI | InChI=1S/C14H22N2O2/c1-2-3-4-9-16-11-12(10-13(16)14(17)18)15-7-5-6-8-15/h5-8,12-13H,2-4,9-11H2,1H3,(H,17,18) |
| InChIKey | OOGIFNAUHHFJKS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|