About tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane
tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane (PubChem CID 172784072) has the molecular formula C16H31N3SSn
and a molecular weight of 416.22 g/mol. Its IUPAC name is tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane |
| PubChem CID | 172784072 |
| Molecular Formula | C16H31N3SSn |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ncnc(SC)n1 |
| InChI | InChI=1S/C4H4N3S.3C4H9.Sn/c1-8-4-6-2-5-3-7-4;3*1-3-4-2;/h2H,1H3;3*1,3-4H2,2H3; |
| InChIKey | OQJYNMKXNWOGBW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane?
The IUPAC name of tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane (CID 172784072) is tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane.
What is the SMILES notation for tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane?
The canonical SMILES for tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1ncnc(SC)n1.
What is the InChIKey of tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane?
The InChIKey is OQJYNMKXNWOGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N3S.3C4H9.Sn/c1-8-4-6-2-5-3-7-4;3*1-3-4-2;/h2H,1H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane?
tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane has a molecular weight of 416.22 g/mol, XLogP of 4.65, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(4-methylsulfanyl-1,3,5-triazin-2-yl)stannane is sourced from PubChem (CID 172784072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).