C15H14ClF3N4O2 — CID 172785494
[(3R,5S)-1-(8-chloro-1,7-naphthyridin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamic acid (PubChem CID 172785494) has the molecular formula C15H14ClF3N4O2 and a molecular weight of 374.75 g/mol. Its IUPAC name is [(3R,5S)-1-(8-chloro-1,7-naphthyridin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamic acid.
| Compound Name | [(3R,5S)-1-(8-chloro-1,7-naphthyridin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 172785494 |
| Molecular Formula | C15H14ClF3N4O2 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [(3R,5S)-1-(8-chloro-1,7-naphthyridin-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1C[C@H](C(F)(F)F)CN(c2cnc(Cl)c3ncccc23)C1 |
| InChI | InChI=1S/C15H14ClF3N4O2/c16-13-12-10(2-1-3-20-12)11(5-21-13)23-6-8(15(17,18)19)4-9(7-23)22-14(24)25/h1-3,5,8-9,22H,4,6-7H2,(H,24,25)/t8-,9+/m0/s1 |
| InChIKey | OVIKZOZPHIKMAJ-DTWKUNHWSA-N |
| XLogP | 3.31 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|