C6H8N4O3 — CID 172786142
7-hydroxy-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione (PubChem CID 172786142) has the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. Its IUPAC name is 7-hydroxy-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione.
| Compound Name | 7-hydroxy-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 172786142 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 7-hydroxy-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione |
| SMILES | O=C1NC(=O)C2NCC(O)N=C2N1 |
| InChI | InChI=1S/C6H8N4O3/c11-2-1-7-3-4(8-2)9-6(13)10-5(3)12/h2-3,7,11H,1H2,(H2,8,9,10,12,13) |
| InChIKey | OXNFXNPQEPJNKY-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |